Calculate the amount of benzoic acid (C6 | Class 12 Chemistry Chapter Solutions, Solutions NCERT Solutions

How the following conversions can be carried out?

(i) Propene to propan-1-ol

(ii) Ethanol to but-1-yne

(iii) 1-Bromopropane to 2-bromopropane

(iv) Toluene to benzyl alcohol

(v) Benzene to 4-bromonitrobenzene

(vi) Benzyl alcohol to 2-phenylethanoic acid

(vii) Ethanol to propanenitrile

(viii) Aniline to chlorobenzene

(ix) 2-Chlorobutane to 3, 4-dimethylhexane

(x) 2-Methyl-1-propene to 2-chloro-2-methylpropane

(xi) Ethyl chloride to propanoic acid

(xii) But-1-ene to n-butyliodide

(xiii) 2-Chloropropane to 1-propanol

(xiv) Isopropyl alcohol to iodoform

(xv) Chlorobenzene to p-nitrophenol

(xvi) 2-Bromopropane to 1-bromopropane

(xvii) Chloroethane to butane

(xviii) Benzene to diphenyl

(xix) tert-Butyl bromide to isobutyl bromide

(xx) Aniline to phenylisocyanide

Give simple chemical tests to distinguish between the following pairs of compounds.

(i) Propanal and Propanone

(ii) Acetophenone and Benzophenone

(iii) Phenol and Benzoic acid

(iv) Benzoic acid and Ethyl benzoate

(v) Pentan-2-one and Pentan-3-one

(vi) Benzaldehyde and Acetophenone

(vii) Ethanal and Propanal

A 5% solution (by mass) of cane sugar in water has freezing point of 271 K. Calculate the freezing point of 5% glucose in water if freezing point of pure water is 273.15 K.

A solution of glucose in water is labelled as 10% w/w, what would be the molality and mole fraction of each component in the solution? If the density of solution is 1.2 g mL^-1, then what shall be the molarity of the solution?

Henry's law constant for CO₂ in water is 1.67 x 10⁸Pa at 298 K. Calculate the quantity of CO₂in 500 mL of soda water when packed under 2.5 atm CO₂ pressure at 298 K.

Calculate the mass of a non-volatile solute (molar mass 40 g mol^-1) which should be dissolved in 114 g octane to reduce its vapour pressure to 80%.

The vapour pressure of pure liquids A and B are 450 and 700 mm Hg respectively, at 350 K. Find out the composition of the liquid mixture if total vapour pressure is 600 mm Hg. Also find the composition of the vapour phase.

Calculate the mole fraction of benzene in solution containing 30% by mass in carbon tetrachloride.

How many mL of 0.1 M HCl are required to react completely with 1 g mixture of Na₂CO₃ and NaHCO₃ containing equimolar amounts of both?

If NaCl is doped with 10^-3mol % of SrCl₂, what is the concentration of cation vacancies?

Give two examples to show the anomalous behaviour of fluorine.

What is crystal field splitting energy? How does the magnitude of Δ_o decide the actual configuration of d-orbitals in a coordination entity?

Name the following compounds according to IUPAC system of nomenclature:

(i) CH3CH(CH3)CH2CH2CHO

(ii) CH3CH2COCH(C2H5)CH2CH2Cl

(iii) CH3CH=CHCHO

(iv) CH3COCH2COCH3

(v) CH3CH(CH3)CH2C(CH3)2COCH3

(vi) (CH3)3CCH2COOH

(vii) OHCC6H4CHO-p

For the reaction:

2A + B → A₂B

the rate = k[A][B]²with k= 2.0 x 10^-6mol^-2L²s^-1. Calculate the initial rate of the reaction when [A] = 0.1 mol L^-1, [B] = 0.2 mol L^-1. Calculate the rate of reaction after [A] is reduced to 0.06 mol L^-1.

The decomposition of dimethyl ether leads to the formation of CH₄, H₂and CO and the reaction rate is given by

Rate = k [CH₃OCH₃]^3/2

The rate of reaction is followed by increase in pressure in a closed vessel, so the rate can also be expressed in terms of the partial pressure of dimethyl ether, i.e.,

 Rate = k (P_CH3OCH3)^3/2

If the pressure is measured in bar andtime in minutes, then what are the units of rate and rate constants?

Discuss the general characteristics of Group 15 elements with reference to their electronic configuration, oxidation state, atomic size, ionisation enthalpy and electronegativity.

What are the common types of secondary structure of proteins?

Is it true that under certain conditions, Mg can reduce SiO₂ and Si can reduce MgO? What are those conditions?

For a first order reaction, show that time required for 99% completion is twice the time required for the completion of 90% of reaction.

Based on solute-solvent interactions, arrange the following in order of increasing solubility in n-octane and explain. Cyclohexane, KCl, CH₃OH, CH₃CN.